C39H40BN3O2 — CID 163826307
4-[3-(2-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 163826307) has the molecular formula C39H40BN3O2 and a molecular weight of 593.58 g/mol. Its IUPAC name is 4-[3-(2-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[3-(2-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163826307 |
| Molecular Formula | C39H40BN3O2 |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | 4-[3-(2-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(C3=C(C4=CC=CCC4)CCC=C3)cc(C3N=C(c4ccccc4)NC(c4ccccc4)=N3)c2)OC1(C)C |
| InChI | InChI=1S/C39H40BN3O2/c1-38(2)39(3,4)45-40(44-38)32-25-30(34-23-15-14-22-33(34)27-16-8-5-9-17-27)24-31(26-32)37-42-35(28-18-10-6-11-19-28)41-36(43-37)29-20-12-7-13-21-29/h5-8,10-13,15-16,18-21,23-26,37H,9,14,17,22H2,1-4H3,(H,41,42,43) |
| InChIKey | NZUCNARBYQXQAF-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|