About 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine
1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine (PubChem CID 163826376) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine.
Molecular Properties
| Compound Name | 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine |
| PubChem CID | 163826376 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine |
| SMILES | C=C(C)C/N=C(C)/C=N/C |
| InChI | InChI=1S/C8H14N2/c1-7(2)5-10-8(3)6-9-4/h6H,1,5H2,2-4H3/b9-6+,10-8+ |
| InChIKey | NZVHYRUARAPQFR-OAMUUVBCSA-N |
| XLogP | 1.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine?
The IUPAC name of 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine (CID 163826376) is 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine.
What is the SMILES notation for 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine?
The canonical SMILES for 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine is C=C(C)C/N=C(C)/C=N/C.
What is the InChIKey of 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine?
The InChIKey is NZVHYRUARAPQFR-OAMUUVBCSA-N. The full InChI is InChI=1S/C8H14N2/c1-7(2)5-10-8(3)6-9-4/h6H,1,5H2,2-4H3/b9-6+,10-8+.
What are the key properties of 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine?
1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine has a molecular weight of 138.21 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-2-N-(2-methylprop-2-enyl)propane-1,2-diimine is sourced from PubChem (CID 163826376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).