C21H27FN4O5 — CID 163827316
6-[[(1R,4R,5S,9R,12R,13S)-5-ethenyl-1,9-dimethyl-4-(methylideneamino)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one (PubChem CID 163827316) has the molecular formula C21H27FN4O5 and a molecular weight of 434.47 g/mol. Its IUPAC name is 6-[[(1R,4R,5S,9R,12R,13S)-5-ethenyl-1,9-dimethyl-4-(methylideneamino)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one.
| Compound Name | 6-[[(1R,4R,5S,9R,12R,13S)-5-ethenyl-1,9-dimethyl-4-(methylideneamino)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 163827316 |
| Molecular Formula | C21H27FN4O5 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-[[(1R,4R,5S,9R,12R,13S)-5-ethenyl-1,9-dimethyl-4-(methylideneamino)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one |
| SMILES | C=C[C@@H]1CCC2[C@@H](C)C(Nc3[nH]c(=O)ncc3F)O[C@@H]3O[C@@]4(C)CC[C@]1(N=C)[C@@]23OO4 |
| InChI | InChI=1S/C21H27FN4O5/c1-5-12-6-7-13-11(2)16(25-15-14(22)10-24-18(27)26-15)28-17-21(13)20(12,23-4)9-8-19(3,29-17)30-31-21/h5,10-13,16-17H,1,4,6-9H2,2-3H3,(H2,24,25,26,27)/t11-,12-,13?,16?,17-,19-,20-,21-/m1/s1 |
| InChIKey | OAPQBJFEWIMPJI-GMIIHRIXSA-N |
| XLogP | 2.52 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|