C39H27N3O — CID 163827341
2,4-diphenyl-6-[1-(4-phenylphenyl)dibenzofuran-3-yl]-1,4-dihydro-1,3,5-triazine (PubChem CID 163827341) has the molecular formula C39H27N3O and a molecular weight of 553.67 g/mol. Its IUPAC name is 2,4-diphenyl-6-[1-(4-phenylphenyl)dibenzofuran-3-yl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[1-(4-phenylphenyl)dibenzofuran-3-yl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163827341 |
| Molecular Formula | C39H27N3O |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2,4-diphenyl-6-[1-(4-phenylphenyl)dibenzofuran-3-yl]-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccccc3)N=C(c3cc(-c4ccc(-c5ccccc5)cc4)c4c(c3)oc3ccccc34)N2)cc1 |
| InChI | InChI=1S/C39H27N3O/c1-4-12-26(13-5-1)27-20-22-28(23-21-27)33-24-31(25-35-36(33)32-18-10-11-19-34(32)43-35)39-41-37(29-14-6-2-7-15-29)40-38(42-39)30-16-8-3-9-17-30/h1-25,37H,(H,40,41,42) |
| InChIKey | OGSJMXFKWPXKON-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |