C23H22F6 — CID 163828317
1-[1,1,1,3,3,3-hexafluoro-2-(4-pent-4-enylphenyl)propan-2-yl]-4-prop-1-en-2-ylbenzene (PubChem CID 163828317) has the molecular formula C23H22F6 and a molecular weight of 412.42 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(4-pent-4-enylphenyl)propan-2-yl]-4-prop-1-en-2-ylbenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(4-pent-4-enylphenyl)propan-2-yl]-4-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 163828317 |
| Molecular Formula | C23H22F6 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(4-pent-4-enylphenyl)propan-2-yl]-4-prop-1-en-2-ylbenzene |
| SMILES | C=CCCCc1ccc(C(c2ccc(C(=C)C)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F6/c1-4-5-6-7-17-8-12-19(13-9-17)21(22(24,25)26,23(27,28)29)20-14-10-18(11-15-20)16(2)3/h4,8-15H,1-2,5-7H2,3H3 |
| InChIKey | OBLUFBYMDDBKAJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|