About 3-propyl-2,3-dihydroquinolin-1-ium
3-propyl-2,3-dihydroquinolin-1-ium (PubChem CID 163828726) has the molecular formula C12H16N+
and a molecular weight of 174.27 g/mol. Its IUPAC name is 3-propyl-2,3-dihydroquinolin-1-ium.
Molecular Properties
| Compound Name | 3-propyl-2,3-dihydroquinolin-1-ium |
| PubChem CID | 163828726 |
| Molecular Formula | C12H16N+ |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 3-propyl-2,3-dihydroquinolin-1-ium |
| SMILES | CCCC1C=c2ccccc2=[NH+]C1 |
| InChI | InChI=1S/C12H15N/c1-2-5-10-8-11-6-3-4-7-12(11)13-9-10/h3-4,6-8,10H,2,5,9H2,1H3/p+1 |
| InChIKey | OBUWXEDDIABWPM-UHFFFAOYSA-O |
| XLogP | -0.40 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-propyl-2,3-dihydroquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-2,3-dihydroquinolin-1-ium?
The IUPAC name of 3-propyl-2,3-dihydroquinolin-1-ium (CID 163828726) is 3-propyl-2,3-dihydroquinolin-1-ium.
What is the SMILES notation for 3-propyl-2,3-dihydroquinolin-1-ium?
The canonical SMILES for 3-propyl-2,3-dihydroquinolin-1-ium is CCCC1C=c2ccccc2=[NH+]C1.
What is the InChIKey of 3-propyl-2,3-dihydroquinolin-1-ium?
The InChIKey is OBUWXEDDIABWPM-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H15N/c1-2-5-10-8-11-6-3-4-7-12(11)13-9-10/h3-4,6-8,10H,2,5,9H2,1H3/p+1.
What are the key properties of 3-propyl-2,3-dihydroquinolin-1-ium?
3-propyl-2,3-dihydroquinolin-1-ium has a molecular weight of 174.27 g/mol, XLogP of -0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-2,3-dihydroquinolin-1-ium is sourced from PubChem (CID 163828726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).