C19H22ClFN4O5 — CID 163828921
(2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)-4a,7a-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol (PubChem CID 163828921) has the molecular formula C19H22ClFN4O5 and a molecular weight of 440.86 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)-4a,7a-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)-4a,7a-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 163828921 |
| Molecular Formula | C19H22ClFN4O5 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)-4a,7a-dihydropyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol |
| SMILES | CONC1=NC=NC2C1C=CN2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)c(F)c2)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C19H22ClFN4O5/c1-19(28)14(27)18(25-6-5-10-16(24-29-2)22-8-23-17(10)25)30-15(19)13(26)9-3-4-11(20)12(21)7-9/h3-8,10,13-15,17-18,26-28H,1-2H3,(H,22,23,24)/t10?,13-,14+,15-,17?,18-,19+/m1/s1 |
| InChIKey | OBZAHZVUTPRAIJ-ZDJLCBMBSA-N |
| XLogP | 0.71 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|