C10H25N9 — CID 163829284
5-(methylideneamino)-6-propan-2-ylcyclohex-5-ene-1,1,2,2,3,3,4,4-octamine (PubChem CID 163829284) has the molecular formula C10H25N9 and a molecular weight of 271.37 g/mol. Its IUPAC name is 5-(methylideneamino)-6-propan-2-ylcyclohex-5-ene-1,1,2,2,3,3,4,4-octamine.
| Compound Name | 5-(methylideneamino)-6-propan-2-ylcyclohex-5-ene-1,1,2,2,3,3,4,4-octamine |
|---|---|
| PubChem CID | 163829284 |
| Molecular Formula | C10H25N9 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | 5-(methylideneamino)-6-propan-2-ylcyclohex-5-ene-1,1,2,2,3,3,4,4-octamine |
| SMILES | C=NC1=C(C(C)C)C(N)(N)C(N)(N)C(N)(N)C1(N)N |
| InChI | InChI=1S/C10H25N9/c1-4(2)5-6(19-3)8(13,14)10(17,18)9(15,16)7(5,11)12/h4H,3,11-18H2,1-2H3 |
| InChIKey | OCGQOVBKCPJYQO-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 220.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|