About 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine
2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine (PubChem CID 163829536) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine |
| PubChem CID | 163829536 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine |
| SMILES | CC1=NCCN1C1=NC=CCC1 |
| InChI | InChI=1S/C9H13N3/c1-8-10-6-7-12(8)9-4-2-3-5-11-9/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | OCMCDVDEVGRSIY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine?
The IUPAC name of 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine (CID 163829536) is 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine.
What is the SMILES notation for 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine?
The canonical SMILES for 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine is CC1=NCCN1C1=NC=CCC1.
What is the InChIKey of 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine?
The InChIKey is OCMCDVDEVGRSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-8-10-6-7-12(8)9-4-2-3-5-11-9/h3,5H,2,4,6-7H2,1H3.
What are the key properties of 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine?
2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine has a molecular weight of 163.22 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-4,5-dihydroimidazol-1-yl)-3,4-dihydropyridine is sourced from PubChem (CID 163829536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).