C22H18N4O — CID 163829959
10-amino-8-oxo-15-piperidin-1-yl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-16-carbonitrile (PubChem CID 163829959) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is 10-amino-8-oxo-15-piperidin-1-yl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-16-carbonitrile.
| Compound Name | 10-amino-8-oxo-15-piperidin-1-yl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-16-carbonitrile |
|---|---|
| PubChem CID | 163829959 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 10-amino-8-oxo-15-piperidin-1-yl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-16-carbonitrile |
| SMILES | N#Cc1c(N2CCCCC2)nc2ccc(N)c3c2c1-c1ccccc1C3=O |
| InChI | InChI=1S/C22H18N4O/c23-12-15-18-13-6-2-3-7-14(13)21(27)19-16(24)8-9-17(20(18)19)25-22(15)26-10-4-1-5-11-26/h2-3,6-9H,1,4-5,10-11,24H2 |
| InChIKey | OCVLRWGGFHJUBR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|