C16H20AlN7O — CID 163830124
CID 163830124 (PubChem CID 163830124) has the molecular formula C16H20AlN7O and a molecular weight of 353.37 g/mol.
| Compound Name | CID 163830124 |
|---|---|
| PubChem CID | 163830124 |
| Molecular Formula | C16H20AlN7O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | — |
| SMILES | CN1CN([Al])Cc2cnc(Nc3ccc(N4CCOCC4)nc3)nc21 |
| InChI | InChI=1S/C16H20N7O.Al/c1-22-11-17-8-12-9-19-16(21-15(12)22)20-13-2-3-14(18-10-13)23-4-6-24-7-5-23;/h2-3,9-10H,4-8,11H2,1H3,(H,19,20,21);/q-1;+1 |
| InChIKey | TYFFXXDAEUFDIC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |