About (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium
(3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium (PubChem CID 163830341) has the molecular formula C6H5F2N2+
and a molecular weight of 143.12 g/mol. Its IUPAC name is (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium |
| PubChem CID | 163830341 |
| Molecular Formula | C6H5F2N2+ |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium |
| SMILES | [H]/N=C1\C=C(F)C(F)=CC1=[NH2+] |
| InChI | InChI=1S/C6H4F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H/p+1/b9-5+,10-6? |
| InChIKey | ODDMXWPSFCZJGL-IIWBTEQSSA-O |
| XLogP | -0.07 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium?
The IUPAC name of (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium (CID 163830341) is (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium.
What is the SMILES notation for (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium?
The canonical SMILES for (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium is [H]/N=C1\C=C(F)C(F)=CC1=[NH2+].
What is the InChIKey of (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium?
The InChIKey is ODDMXWPSFCZJGL-IIWBTEQSSA-O. The full InChI is InChI=1S/C6H4F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H/p+1/b9-5+,10-6?.
What are the key properties of (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium?
(3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium has a molecular weight of 143.12 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluoro-6-iminocyclohexa-2,4-dien-1-ylidene)azanium is sourced from PubChem (CID 163830341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).