C11H18O3 — CID 163830358
4-(1-ethoxyethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol (PubChem CID 163830358) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 4-(1-ethoxyethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol.
| Compound Name | 4-(1-ethoxyethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol |
|---|---|
| PubChem CID | 163830358 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4-(1-ethoxyethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol |
| SMILES | CCOC(C)C1=CCC2COC(O)C12 |
| InChI | InChI=1S/C11H18O3/c1-3-13-7(2)9-5-4-8-6-14-11(12)10(8)9/h5,7-8,10-12H,3-4,6H2,1-2H3 |
| InChIKey | ODDUOJLZVWHOGQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|