About [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine
[5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine (PubChem CID 163831309) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine.
Molecular Properties
| Compound Name | [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine |
| PubChem CID | 163831309 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine |
| SMILES | [H]/N=C/c1ccc(/C(=C/C)CC=C)o1 |
| InChI | InChI=1S/C11H13NO/c1-3-5-9(4-2)11-7-6-10(8-12)13-11/h3-4,6-8,12H,1,5H2,2H3/b9-4+,12-8+ |
| InChIKey | SDEZSWIUPSBFTQ-FMQHCKNKSA-N |
| XLogP | 3.26 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine?
The IUPAC name of [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine (CID 163831309) is [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine.
What is the SMILES notation for [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine?
The canonical SMILES for [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine is [H]/N=C/c1ccc(/C(=C/C)CC=C)o1.
What is the InChIKey of [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine?
The InChIKey is SDEZSWIUPSBFTQ-FMQHCKNKSA-N. The full InChI is InChI=1S/C11H13NO/c1-3-5-9(4-2)11-7-6-10(8-12)13-11/h3-4,6-8,12H,1,5H2,2H3/b9-4+,12-8+.
What are the key properties of [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine?
[5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine has a molecular weight of 175.23 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2E)-hexa-2,5-dien-3-yl]furan-2-yl]methanimine is sourced from PubChem (CID 163831309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).