C34H37O5P — CID 163832285
2-methyl-1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(2-methylprop-2-enoyl)benzoyl]phosphoryl]carbonylphenyl]propan-1-one (PubChem CID 163832285) has the molecular formula C34H37O5P and a molecular weight of 556.64 g/mol. Its IUPAC name is 2-methyl-1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(2-methylprop-2-enoyl)benzoyl]phosphoryl]carbonylphenyl]propan-1-one.
| Compound Name | 2-methyl-1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(2-methylprop-2-enoyl)benzoyl]phosphoryl]carbonylphenyl]propan-1-one |
|---|---|
| PubChem CID | 163832285 |
| Molecular Formula | C34H37O5P |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 2-methyl-1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(2-methylprop-2-enoyl)benzoyl]phosphoryl]carbonylphenyl]propan-1-one |
| SMILES | C=C(C)C(=O)c1c(C)cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)c(C(=O)C(C)C)c2C)c2ccccc2)c1C |
| InChI | InChI=1S/C34H37O5P/c1-18(2)31(35)27-20(5)16-22(7)29(24(27)9)33(37)40(39,26-14-12-11-13-15-26)34(38)30-23(8)17-21(6)28(25(30)10)32(36)19(3)4/h11-17,19H,1H2,2-10H3 |
| InChIKey | OEQZZZYBTLXIOE-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|