C21H21N5OS — CID 163832523
[5-[3-[(4-amino-3-buta-1,3-dienylphenyl)methyl]-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophen-2-yl]methanol (PubChem CID 163832523) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is [5-[3-[(4-amino-3-buta-1,3-dienylphenyl)methyl]-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophen-2-yl]methanol.
| Compound Name | [5-[3-[(4-amino-3-buta-1,3-dienylphenyl)methyl]-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 163832523 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [5-[3-[(4-amino-3-buta-1,3-dienylphenyl)methyl]-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophen-2-yl]methanol |
| SMILES | C=CC=Cc1cc(CN2NNc3ccc(-c4ccc(CO)s4)nc32)ccc1N |
| InChI | InChI=1S/C21H21N5OS/c1-2-3-4-15-11-14(5-7-17(15)22)12-26-21-19(24-25-26)9-8-18(23-21)20-10-6-16(13-27)28-20/h2-11,24-25,27H,1,12-13,22H2 |
| InChIKey | OEWQBCXZYKUDSD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|