C16H26O5 — CID 163832671
methyl (2'R,4'S,6'aS)-2'-hydroxy-4',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate (PubChem CID 163832671) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl (2'R,4'S,6'aS)-2'-hydroxy-4',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate.
| Compound Name | methyl (2'R,4'S,6'aS)-2'-hydroxy-4',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 163832671 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | methyl (2'R,4'S,6'aS)-2'-hydroxy-4',5,5-trimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
| SMILES | COC(=O)C1[C@H]2CC3(OCC(C)(C)CO3)[C@@H](C)C2C[C@H]1O |
| InChI | InChI=1S/C16H26O5/c1-9-10-5-12(17)13(14(18)19-4)11(10)6-16(9)20-7-15(2,3)8-21-16/h9-13,17H,5-8H2,1-4H3/t9-,10?,11-,12+,13?/m0/s1 |
| InChIKey | OEZVAMUKUHHBAE-PHKUEXBLSA-N |
| XLogP | 1.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |