C39H61N4O4+ — CID 163833005
[5-[2-[2-[di(propan-2-yl)carbamoyloxymethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]ethyl]-1,2-dimethylcyclohexa-2,4-dien-1-yl]methyl N,N-di(propan-2-yl)carbamate (PubChem CID 163833005) has the molecular formula C39H61N4O4+ and a molecular weight of 649.94 g/mol. Its IUPAC name is [5-[2-[2-[di(propan-2-yl)carbamoyloxymethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]ethyl]-1,2-dimethylcyclohexa-2,4-dien-1-yl]methyl N,N-di(propan-2-yl)carbamate.
| Compound Name | [5-[2-[2-[di(propan-2-yl)carbamoyloxymethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]ethyl]-1,2-dimethylcyclohexa-2,4-dien-1-yl]methyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 163833005 |
| Molecular Formula | C39H61N4O4+ |
| Molecular Weight | 649.94 g/mol |
| Exact Mass | 649.47 |
| IUPAC Name | [5-[2-[2-[di(propan-2-yl)carbamoyloxymethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]ethyl]-1,2-dimethylcyclohexa-2,4-dien-1-yl]methyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC1=CC=C(CCn2c3c(c4cc(C)ccc42)C[N+](C)(COC(=O)N(C(C)C)C(C)C)CC3)CC1(C)COC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C39H61N4O4/c1-26(2)41(27(3)4)37(44)46-24-39(11)22-32(15-14-31(39)10)17-19-40-35-16-13-30(9)21-33(35)34-23-43(12,20-18-36(34)40)25-47-38(45)42(28(5)6)29(7)8/h13-16,21,26-29H,17-20,22-25H2,1-12H3/q+1 |
| InChIKey | GCDSQTHRBKVHIL-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.94 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|