C14H16N6O5S — CID 163833671
N-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-4-sulfamoylbenzeneamine oxide (PubChem CID 163833671) has the molecular formula C14H16N6O5S and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-4-sulfamoylbenzeneamine oxide.
| Compound Name | N-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-4-sulfamoylbenzeneamine oxide |
|---|---|
| PubChem CID | 163833671 |
| Molecular Formula | C14H16N6O5S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl]-4-sulfamoylbenzeneamine oxide |
| SMILES | Cn1c(=O)c2c(ncn2C[NH+]([O-])c2ccc(S(N)(=O)=O)cc2)n(C)c1=O |
| InChI | InChI=1S/C14H16N6O5S/c1-17-12-11(13(21)18(2)14(17)22)19(7-16-12)8-20(23)9-3-5-10(6-4-9)26(15,24)25/h3-7,20H,8H2,1-2H3,(H2,15,24,25) |
| InChIKey | OFVJBZKXMNXGKC-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|