C21H23N5O — CID 163834753
(11Z,13R)-13,16-dimethyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,14,18,20-heptaen-6-one (PubChem CID 163834753) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is (11Z,13R)-13,16-dimethyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,14,18,20-heptaen-6-one.
| Compound Name | (11Z,13R)-13,16-dimethyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,14,18,20-heptaen-6-one |
|---|---|
| PubChem CID | 163834753 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (11Z,13R)-13,16-dimethyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,14,18,20-heptaen-6-one |
| SMILES | CC1Nc2cccc3c2N/C1=N\[C@H](C)/C=C\CC1CNC(=O)c2cc-3[nH]c21 |
| InChI | InChI=1S/C21H23N5O/c1-11-5-3-6-13-10-22-21(27)15-9-17(25-18(13)15)14-7-4-8-16-19(14)26-20(23-11)12(2)24-16/h3-5,7-9,11-13,24-25H,6,10H2,1-2H3,(H,22,27)(H,23,26)/b5-3-/t11-,12?,13?/m1/s1 |
| InChIKey | OGUBETIUXOOBKZ-BEIBFZRPSA-N |
| XLogP | 3.48 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|