C21H20FN3O4 — CID 163836386
1-[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]-3-hydroxy-N-methyl-3-oxopropan-1-amine oxide (PubChem CID 163836386) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]-3-hydroxy-N-methyl-3-oxopropan-1-amine oxide.
| Compound Name | 1-[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]-3-hydroxy-N-methyl-3-oxopropan-1-amine oxide |
|---|---|
| PubChem CID | 163836386 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]-3-hydroxy-N-methyl-3-oxopropan-1-amine oxide |
| SMILES | C[NH+]([O-])C(CC(=O)O)c1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1 |
| InChI | InChI=1S/C21H20FN3O4/c1-25(29)17(10-18(26)27)11-2-4-12(5-3-11)20-14-6-7-23-21(28)15-8-13(22)9-16(24-20)19(14)15/h2-5,8-9,17,24-25H,6-7,10H2,1H3,(H,23,28)(H,26,27) |
| InChIKey | OICCMYFGKZSTOR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|