About 3-[(2S)-2,3-dimethylbutyl]cyclohexene
3-[(2S)-2,3-dimethylbutyl]cyclohexene (PubChem CID 163836569) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 3-[(2S)-2,3-dimethylbutyl]cyclohexene.
Molecular Properties
| Compound Name | 3-[(2S)-2,3-dimethylbutyl]cyclohexene |
| PubChem CID | 163836569 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 3-[(2S)-2,3-dimethylbutyl]cyclohexene |
| SMILES | CC(C)[C@@H](C)CC1C=CCCC1 |
| InChI | InChI=1S/C12H22/c1-10(2)11(3)9-12-7-5-4-6-8-12/h5,7,10-12H,4,6,8-9H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | OIGLBMFBRZIOQQ-PXYINDEMSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S)-2,3-dimethylbutyl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2,3-dimethylbutyl]cyclohexene?
The IUPAC name of 3-[(2S)-2,3-dimethylbutyl]cyclohexene (CID 163836569) is 3-[(2S)-2,3-dimethylbutyl]cyclohexene.
What is the SMILES notation for 3-[(2S)-2,3-dimethylbutyl]cyclohexene?
The canonical SMILES for 3-[(2S)-2,3-dimethylbutyl]cyclohexene is CC(C)[C@@H](C)CC1C=CCCC1.
What is the InChIKey of 3-[(2S)-2,3-dimethylbutyl]cyclohexene?
The InChIKey is OIGLBMFBRZIOQQ-PXYINDEMSA-N. The full InChI is InChI=1S/C12H22/c1-10(2)11(3)9-12-7-5-4-6-8-12/h5,7,10-12H,4,6,8-9H2,1-3H3/t11-,12?/m0/s1.
What are the key properties of 3-[(2S)-2,3-dimethylbutyl]cyclohexene?
3-[(2S)-2,3-dimethylbutyl]cyclohexene has a molecular weight of 166.31 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2,3-dimethylbutyl]cyclohexene is sourced from PubChem (CID 163836569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).