C12H22 — CID 163836569
3-[(2S)-2,3-dimethylbutyl]cyclohexene (PubChem CID 163836569) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 3-[(2S)-2,3-dimethylbutyl]cyclohexene.
| Compound Name | 3-[(2S)-2,3-dimethylbutyl]cyclohexene |
|---|---|
| PubChem CID | 163836569 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 3-[(2S)-2,3-dimethylbutyl]cyclohexene |
| SMILES | CC(C)[C@@H](C)CC1C=CCCC1 |
| InChI | InChI=1S/C12H22/c1-10(2)11(3)9-12-7-5-4-6-8-12/h5,7,10-12H,4,6,8-9H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | OIGLBMFBRZIOQQ-PXYINDEMSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|