About (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane
(6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane (PubChem CID 163836831) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane.
Molecular Properties
| Compound Name | (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane |
| PubChem CID | 163836831 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane |
| SMILES | CCC1[C@H](C)[C@H](C)CCC12CC2 |
| InChI | InChI=1S/C12H22/c1-4-11-10(3)9(2)5-6-12(11)7-8-12/h9-11H,4-8H2,1-3H3/t9-,10-,11?/m1/s1 |
| InChIKey | OIMAKDMXVQGCMR-DIOIDXFWSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane?
The IUPAC name of (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane (CID 163836831) is (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane.
What is the SMILES notation for (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane?
The canonical SMILES for (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane is CCC1[C@H](C)[C@H](C)CCC12CC2.
What is the InChIKey of (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane?
The InChIKey is OIMAKDMXVQGCMR-DIOIDXFWSA-N. The full InChI is InChI=1S/C12H22/c1-4-11-10(3)9(2)5-6-12(11)7-8-12/h9-11H,4-8H2,1-3H3/t9-,10-,11?/m1/s1.
What are the key properties of (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane?
(6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane has a molecular weight of 166.31 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7R)-8-ethyl-6,7-dimethylspiro[2.5]octane is sourced from PubChem (CID 163836831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).