C40H27N3 — CID 163836972
4-[4-(9H-fluoren-4-yl)phenyl]-2-(4-phenylphenyl)-6-pyridin-3-ylpyrimidine (PubChem CID 163836972) has the molecular formula C40H27N3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 4-[4-(9H-fluoren-4-yl)phenyl]-2-(4-phenylphenyl)-6-pyridin-3-ylpyrimidine.
| Compound Name | 4-[4-(9H-fluoren-4-yl)phenyl]-2-(4-phenylphenyl)-6-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 163836972 |
| Molecular Formula | C40H27N3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-[4-(9H-fluoren-4-yl)phenyl]-2-(4-phenylphenyl)-6-pyridin-3-ylpyrimidine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5cccc6c5-c5ccccc5C6)cc4)cc(-c4cccnc4)n3)cc2)cc1 |
| InChI | InChI=1S/C40H27N3/c1-2-8-27(9-3-1)28-15-21-31(22-16-28)40-42-37(25-38(43-40)34-12-7-23-41-26-34)30-19-17-29(18-20-30)35-14-6-11-33-24-32-10-4-5-13-36(32)39(33)35/h1-23,25-26H,24H2 |
| InChIKey | OIPDQOCIIIEHPZ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |