C29H27F4NO3 — CID 163837073
[cyano-(3-phenoxyphenyl)methyl] 2,2,3-trimethyl-3-[(2,3,4,5-tetrafluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclopropane-1-carboxylate (PubChem CID 163837073) has the molecular formula C29H27F4NO3 and a molecular weight of 513.53 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2,2,3-trimethyl-3-[(2,3,4,5-tetrafluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclopropane-1-carboxylate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2,2,3-trimethyl-3-[(2,3,4,5-tetrafluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163837073 |
| Molecular Formula | C29H27F4NO3 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2,2,3-trimethyl-3-[(2,3,4,5-tetrafluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1C(CC2(C)C(C(=O)OC(C#N)c3cccc(Oc4ccccc4)c3)C2(C)C)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C29H27F4NO3/c1-16-20(23(31)25(33)24(32)22(16)30)14-29(4)26(28(29,2)3)27(35)37-21(15-34)17-9-8-12-19(13-17)36-18-10-6-5-7-11-18/h5-13,16,21-22,26H,14H2,1-4H3 |
| InChIKey | OIRJGRKOOWUQFJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |