About 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one
10-hydroxy-9a,10-dihydro-1H-anthracen-9-one (PubChem CID 163837296) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one.
Molecular Properties
| Compound Name | 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one |
| PubChem CID | 163837296 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one |
| SMILES | O=C1c2ccccc2C(O)C2=CC=CCC12 |
| InChI | InChI=1S/C14H12O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-7,12-13,15H,8H2 |
| InChIKey | OIWKIOBHKZGZRQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one?
The IUPAC name of 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one (CID 163837296) is 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one.
What is the SMILES notation for 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one?
The canonical SMILES for 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one is O=C1c2ccccc2C(O)C2=CC=CCC12.
What is the InChIKey of 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one?
The InChIKey is OIWKIOBHKZGZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-7,12-13,15H,8H2.
What are the key properties of 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one?
10-hydroxy-9a,10-dihydro-1H-anthracen-9-one has a molecular weight of 212.25 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-9a,10-dihydro-1H-anthracen-9-one is sourced from PubChem (CID 163837296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).