About 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one
3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one (PubChem CID 163837702) has the molecular formula C9H17F3OSi
and a molecular weight of 226.31 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one |
| PubChem CID | 163837702 |
| Molecular Formula | C9H17F3OSi |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3OSi/c1-8(2,3)14(4,5)6-7(13)9(10,11)12/h6H2,1-5H3 |
| InChIKey | QJIVSHLYNKKRSU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one (CID 163837702) is 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one is CC(C)(C)[Si](C)(C)CC(=O)C(F)(F)F.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one?
The InChIKey is QJIVSHLYNKKRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3OSi/c1-8(2,3)14(4,5)6-7(13)9(10,11)12/h6H2,1-5H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one?
3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one has a molecular weight of 226.31 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]-1,1,1-trifluoropropan-2-one is sourced from PubChem (CID 163837702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).