About 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole
2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole (PubChem CID 163838090) has the molecular formula C15H13F3N2O3S
and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole |
| PubChem CID | 163838090 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1cccnc1C1=NC2CC(C(F)(F)F)=CC=C2O1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-2-24(21,22)12-4-3-7-19-13(12)14-20-10-8-9(15(16,17)18)5-6-11(10)23-14/h3-7,10H,2,8H2,1H3 |
| InChIKey | OJNXLEMBYKIUKS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole?
The IUPAC name of 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole (CID 163838090) is 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole.
What is the SMILES notation for 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole?
The canonical SMILES for 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole is CCS(=O)(=O)c1cccnc1C1=NC2CC(C(F)(F)F)=CC=C2O1.
What is the InChIKey of 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole?
The InChIKey is OJNXLEMBYKIUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O3S/c1-2-24(21,22)12-4-3-7-19-13(12)14-20-10-8-9(15(16,17)18)5-6-11(10)23-14/h3-7,10H,2,8H2,1H3.
What are the key properties of 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole?
2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole has a molecular weight of 358.34 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethyl)-3a,4-dihydro-1,3-benzoxazole is sourced from PubChem (CID 163838090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).