About 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine
1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine (PubChem CID 163838264) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine.
Analyze 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine?
The IUPAC name of 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine (CID 163838264) is 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine.
What is the SMILES notation for 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine?
The canonical SMILES for 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine is CC1CCc2c(cnn2C)N1.
What is the InChIKey of 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine?
The InChIKey is OJRIYOBSIJHOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-3-4-8-7(10-6)5-9-11(8)2/h5-6,10H,3-4H2,1-2H3.
What are the key properties of 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine?
1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine has a molecular weight of 151.21 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine is sourced from PubChem (CID 163838264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).