C8H10AlN5S — CID 163838805
1-alumanyl-N-[4-ethyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine (PubChem CID 163838805) has the molecular formula C8H10AlN5S and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-alumanyl-N-[4-ethyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine.
| Compound Name | 1-alumanyl-N-[4-ethyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 163838805 |
| Molecular Formula | C8H10AlN5S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-alumanyl-N-[4-ethyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine |
| SMILES | CCc1nc(N=C[AlH2])sc1-n1cncn1 |
| InChI | InChI=1S/C8H8N5S.Al.2H/c1-3-6-7(13-5-10-4-11-13)14-8(9-2)12-6;;;/h2,4-5H,3H2,1H3;;; |
| InChIKey | OKCLRCVHJYUKSJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|