C10H16N2O — CID 163839336
N'-hydroxy-2,3,5,6,7,7a-hexahydro-1H-indene-4-carboximidamide (PubChem CID 163839336) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-hydroxy-2,3,5,6,7,7a-hexahydro-1H-indene-4-carboximidamide.
| Compound Name | N'-hydroxy-2,3,5,6,7,7a-hexahydro-1H-indene-4-carboximidamide |
|---|---|
| PubChem CID | 163839336 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N'-hydroxy-2,3,5,6,7,7a-hexahydro-1H-indene-4-carboximidamide |
| SMILES | NC(=NO)C1=C2CCCC2CCC1 |
| InChI | InChI=1S/C10H16N2O/c11-10(12-13)9-6-2-4-7-3-1-5-8(7)9/h7,13H,1-6H2,(H2,11,12) |
| InChIKey | OKNQHCARDREAOI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|