C22H18ClN4S2+ — CID 163839721
S-[3-[[8-(3-chlorophenyl)-5,6-dihydrothieno[2,3-h]quinazolin-3-ium-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 163839721) has the molecular formula C22H18ClN4S2+ and a molecular weight of 438.00 g/mol. Its IUPAC name is S-[3-[[8-(3-chlorophenyl)-5,6-dihydrothieno[2,3-h]quinazolin-3-ium-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[3-[[8-(3-chlorophenyl)-5,6-dihydrothieno[2,3-h]quinazolin-3-ium-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 163839721 |
| Molecular Formula | C22H18ClN4S2+ |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | S-[3-[[8-(3-chlorophenyl)-5,6-dihydrothieno[2,3-h]quinazolin-3-ium-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1cccc(Nc2nc3c(c[nH+]2)CCc2sc(-c4cccc(Cl)c4)cc2-3)c1 |
| InChI | InChI=1S/C22H17ClN4S2/c23-15-4-1-3-13(9-15)20-11-18-19(28-20)8-7-14-12-25-22(27-21(14)18)26-16-5-2-6-17(10-16)29-24/h1-6,9-12H,7-8,24H2,(H,25,26,27)/p+1 |
| InChIKey | OKWPUPMUGQHDGY-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|