C36H45N7O2 — CID 163839841
N'-[4-ethenyl-2-methoxy-3-(5-methyl-1H-indazol-4-yl)-6-[1-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)ethenyl]phenyl]-1-methylpiperidine-4-carboximidamide (PubChem CID 163839841) has the molecular formula C36H45N7O2 and a molecular weight of 607.80 g/mol. Its IUPAC name is N'-[4-ethenyl-2-methoxy-3-(5-methyl-1H-indazol-4-yl)-6-[1-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)ethenyl]phenyl]-1-methylpiperidine-4-carboximidamide.
| Compound Name | N'-[4-ethenyl-2-methoxy-3-(5-methyl-1H-indazol-4-yl)-6-[1-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)ethenyl]phenyl]-1-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 163839841 |
| Molecular Formula | C36H45N7O2 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.36 |
| IUPAC Name | N'-[4-ethenyl-2-methoxy-3-(5-methyl-1H-indazol-4-yl)-6-[1-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)ethenyl]phenyl]-1-methylpiperidine-4-carboximidamide |
| SMILES | C=CC(=O)N1CC2(CCN(C(=C)c3cc(C=C)c(-c4c(C)ccc5[nH]ncc45)c(OC)c3/N=C(\N)C3CCN(C)CC3)CC2)C1 |
| InChI | InChI=1S/C36H45N7O2/c1-7-25-19-27(24(4)42-17-13-36(14-18-42)21-43(22-36)30(44)8-2)33(39-35(37)26-11-15-41(5)16-12-26)34(45-6)32(25)31-23(3)9-10-29-28(31)20-38-40-29/h7-10,19-20,26H,1-2,4,11-18,21-22H2,3,5-6H3,(H2,37,39)(H,38,40) |
| InChIKey | OKZNVEZEPGIROZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|