C36H54N6O — CID 163839893
N,N-bis(3-methylbutyl)-2-(4-piperidin-1-ylanilino)-3-(3-pyrrolidin-1-ylpropyl)benzimidazole-5-carboxamide (PubChem CID 163839893) has the molecular formula C36H54N6O and a molecular weight of 586.87 g/mol. Its IUPAC name is N,N-bis(3-methylbutyl)-2-(4-piperidin-1-ylanilino)-3-(3-pyrrolidin-1-ylpropyl)benzimidazole-5-carboxamide.
| Compound Name | N,N-bis(3-methylbutyl)-2-(4-piperidin-1-ylanilino)-3-(3-pyrrolidin-1-ylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 163839893 |
| Molecular Formula | C36H54N6O |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | N,N-bis(3-methylbutyl)-2-(4-piperidin-1-ylanilino)-3-(3-pyrrolidin-1-ylpropyl)benzimidazole-5-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc2nc(Nc3ccc(N4CCCCC4)cc3)n(CCCN3CCCC3)c2c1 |
| InChI | InChI=1S/C36H54N6O/c1-28(2)17-25-41(26-18-29(3)4)35(43)30-11-16-33-34(27-30)42(24-10-21-39-19-8-9-20-39)36(38-33)37-31-12-14-32(15-13-31)40-22-6-5-7-23-40/h11-16,27-29H,5-10,17-26H2,1-4H3,(H,37,38) |
| InChIKey | OLAVRTRHQVTILM-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|