C6H10F6NO+ — CID 163841235
(3-amino-4,4,4-trifluorobutyl)-(2,2,2-trifluoroethyl)oxidanium (PubChem CID 163841235) has the molecular formula C6H10F6NO+ and a molecular weight of 226.14 g/mol. Its IUPAC name is (3-amino-4,4,4-trifluorobutyl)-(2,2,2-trifluoroethyl)oxidanium.
| Compound Name | (3-amino-4,4,4-trifluorobutyl)-(2,2,2-trifluoroethyl)oxidanium |
|---|---|
| PubChem CID | 163841235 |
| Molecular Formula | C6H10F6NO+ |
| Molecular Weight | 226.14 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (3-amino-4,4,4-trifluorobutyl)-(2,2,2-trifluoroethyl)oxidanium |
| SMILES | NC(CC[OH+]CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H9F6NO/c7-5(8,9)3-14-2-1-4(13)6(10,11)12/h4H,1-3,13H2/p+1 |
| InChIKey | OMEMVHWGNOFOOO-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|