C18H20N2O5 — CID 163841784
diethyl 2-(pyridin-3-ylmethoxymethyl)pyridine-3,5-dicarboxylate (PubChem CID 163841784) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is diethyl 2-(pyridin-3-ylmethoxymethyl)pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(pyridin-3-ylmethoxymethyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 163841784 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | diethyl 2-(pyridin-3-ylmethoxymethyl)pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cnc(COCc2cccnc2)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-3-24-17(21)14-8-15(18(22)25-4-2)16(20-10-14)12-23-11-13-6-5-7-19-9-13/h5-10H,3-4,11-12H2,1-2H3 |
| InChIKey | OMQHDFUWIIMSRB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |