C29H49NO4 — CID 163843731
(5S)-5-[(3S,8R,10R,12R,14R,17S)-12-(ethylaminooxy)-3-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyloxolan-2-one (PubChem CID 163843731) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is (5S)-5-[(3S,8R,10R,12R,14R,17S)-12-(ethylaminooxy)-3-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(3S,8R,10R,12R,14R,17S)-12-(ethylaminooxy)-3-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 163843731 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | (5S)-5-[(3S,8R,10R,12R,14R,17S)-12-(ethylaminooxy)-3-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyloxolan-2-one |
| SMILES | CCNO[C@@H]1CC2[C@@]3(C)CC[C@H](O)C(C)(C)C3CC[C@@]2(C)[C@]2(C)CCC([C@]3(C)CCC(=O)O3)C12 |
| InChI | InChI=1S/C29H49NO4/c1-8-30-34-19-17-21-26(4)13-11-22(31)25(2,3)20(26)10-15-27(21,5)28(6)14-9-18(24(19)28)29(7)16-12-23(32)33-29/h18-22,24,30-31H,8-17H2,1-7H3/t18?,19-,20?,21?,22+,24?,26+,27-,28-,29+/m1/s1 |
| InChIKey | OOHAOOSBSMYGRN-LAEPPADBSA-N |
| XLogP | 5.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|