C23H35N3O5 — CID 163843954
trans-(1R,2S)-1-[[(2S)-1-[(2S)-2-(cyclopropanecarbonylamino)octanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid (PubChem CID 163843954) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is trans-(1R,2S)-1-[[(2S)-1-[(2S)-2-(cyclopropanecarbonylamino)octanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-1-[[(2S)-1-[(2S)-2-(cyclopropanecarbonylamino)octanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 163843954 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | trans-(1R,2S)-1-[[(2S)-1-[(2S)-2-(cyclopropanecarbonylamino)octanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCCC)NC(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C23H35N3O5/c1-3-5-6-7-9-17(24-19(27)15-11-12-15)21(29)26-13-8-10-18(26)20(28)25-23(22(30)31)14-16(23)4-2/h4,15-18H,2-3,5-14H2,1H3,(H,24,27)(H,25,28)(H,30,31)/t16-,17+,18+,23-/m1/s1 |
| InChIKey | OOLZEQKFCFBLLF-SCYDXJQRSA-N |
| XLogP | 1.99 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|