C13H17NO2 — CID 163843994
1-[(2S,4Z,6Z)-3-methylocta-4,6-dien-2-yl]pyrrole-2,5-dione (PubChem CID 163843994) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[(2S,4Z,6Z)-3-methylocta-4,6-dien-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[(2S,4Z,6Z)-3-methylocta-4,6-dien-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163843994 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[(2S,4Z,6Z)-3-methylocta-4,6-dien-2-yl]pyrrole-2,5-dione |
| SMILES | C/C=C\C=C/C(C)[C@H](C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H17NO2/c1-4-5-6-7-10(2)11(3)14-12(15)8-9-13(14)16/h4-11H,1-3H3/b5-4-,7-6-/t10?,11-/m0/s1 |
| InChIKey | OOMVJTUKNHTXCD-PVINIVILSA-N |
| XLogP | 2.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|