C26H31N3O3S — CID 163844025
tert-butyl 3-amino-2-[(1-hydroxy-2,2-diphenylethyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 163844025) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is tert-butyl 3-amino-2-[(1-hydroxy-2,2-diphenylethyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-amino-2-[(1-hydroxy-2,2-diphenylethyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 163844025 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | tert-butyl 3-amino-2-[(1-hydroxy-2,2-diphenylethyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(sc(NC(O)C(c3ccccc3)c3ccccc3)c2N)C1 |
| InChI | InChI=1S/C26H31N3O3S/c1-26(2,3)32-25(31)29-15-14-19-20(16-29)33-24(22(19)27)28-23(30)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,21,23,28,30H,14-16,27H2,1-3H3 |
| InChIKey | OONLISAZMODQPV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|