About 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol
4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol (PubChem CID 163845176) has the molecular formula C11H22FNO2
and a molecular weight of 219.30 g/mol. Its IUPAC name is 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol.
Molecular Properties
| Compound Name | 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol |
| PubChem CID | 163845176 |
| Molecular Formula | C11H22FNO2 |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol |
| SMILES | CCN1C[C@@H](F)C[C@H]1COCCCCO |
| InChI | InChI=1S/C11H22FNO2/c1-2-13-8-10(12)7-11(13)9-15-6-4-3-5-14/h10-11,14H,2-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | OPNMWMXQEMSJKM-QWRGUYRKSA-N |
| XLogP | 1.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol?
The IUPAC name of 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol (CID 163845176) is 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol.
What is the SMILES notation for 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol?
The canonical SMILES for 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol is CCN1C[C@@H](F)C[C@H]1COCCCCO.
What is the InChIKey of 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol?
The InChIKey is OPNMWMXQEMSJKM-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H22FNO2/c1-2-13-8-10(12)7-11(13)9-15-6-4-3-5-14/h10-11,14H,2-9H2,1H3/t10-,11-/m0/s1.
What are the key properties of 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol?
4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol has a molecular weight of 219.30 g/mol, XLogP of 1.21, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]methoxy]butan-1-ol is sourced from PubChem (CID 163845176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).