C54H51N — CID 163845433
3,6-ditert-butyl-9-[4-(2-tert-butyl-10-naphthalen-1-ylanthracen-9-yl)phenyl]carbazole (PubChem CID 163845433) has the molecular formula C54H51N and a molecular weight of 714.01 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(2-tert-butyl-10-naphthalen-1-ylanthracen-9-yl)phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(2-tert-butyl-10-naphthalen-1-ylanthracen-9-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 163845433 |
| Molecular Formula | C54H51N |
| Molecular Weight | 714.01 g/mol |
| Exact Mass | 713.40 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(2-tert-butyl-10-naphthalen-1-ylanthracen-9-yl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(-c3cccc4ccccc34)c3ccccc3c(-c3ccc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)cc3)c2c1 |
| InChI | InChI=1S/C54H51N/c1-52(2,3)36-23-28-44-47(33-36)50(42-18-12-13-19-43(42)51(44)41-20-14-16-34-15-10-11-17-40(34)41)35-21-26-39(27-22-35)55-48-29-24-37(53(4,5)6)31-45(48)46-32-38(54(7,8)9)25-30-49(46)55/h10-33H,1-9H3 |
| InChIKey | OPSKZYSQYFXWMR-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.01 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|