About 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole
8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole (PubChem CID 163846059) has the molecular formula C19H16IN
and a molecular weight of 385.25 g/mol. Its IUPAC name is 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole.
Molecular Properties
| Compound Name | 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole |
| PubChem CID | 163846059 |
| Molecular Formula | C19H16IN |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole |
| SMILES | Cc1c(CI)ccc2cc3c4ccccc4n(C)c3cc12 |
| InChI | InChI=1S/C19H16IN/c1-12-14(11-20)8-7-13-9-17-15-5-3-4-6-18(15)21(2)19(17)10-16(12)13/h3-10H,11H2,1-2H3 |
| InChIKey | OQGQUMOXJPWFNA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole?
The IUPAC name of 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole (CID 163846059) is 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole.
What is the SMILES notation for 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole?
The canonical SMILES for 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole is Cc1c(CI)ccc2cc3c4ccccc4n(C)c3cc12.
What is the InChIKey of 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole?
The InChIKey is OQGQUMOXJPWFNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16IN/c1-12-14(11-20)8-7-13-9-17-15-5-3-4-6-18(15)21(2)19(17)10-16(12)13/h3-10H,11H2,1-2H3.
What are the key properties of 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole?
8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole has a molecular weight of 385.25 g/mol, XLogP of 5.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(iodomethyl)-5,7-dimethylbenzo[b]carbazole is sourced from PubChem (CID 163846059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).