C18H13Cl2F3N2O3 — CID 163846084
4,6-dichloro-5-[[3,7-dimethyl-5-(trifluoromethyl)indol-1-yl]-hydroxymethyl]pyridine-3-carboxylic acid (PubChem CID 163846084) has the molecular formula C18H13Cl2F3N2O3 and a molecular weight of 433.21 g/mol. Its IUPAC name is 4,6-dichloro-5-[[3,7-dimethyl-5-(trifluoromethyl)indol-1-yl]-hydroxymethyl]pyridine-3-carboxylic acid.
| Compound Name | 4,6-dichloro-5-[[3,7-dimethyl-5-(trifluoromethyl)indol-1-yl]-hydroxymethyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163846084 |
| Molecular Formula | C18H13Cl2F3N2O3 |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 4,6-dichloro-5-[[3,7-dimethyl-5-(trifluoromethyl)indol-1-yl]-hydroxymethyl]pyridine-3-carboxylic acid |
| SMILES | Cc1cn(C(O)c2c(Cl)ncc(C(=O)O)c2Cl)c2c(C)cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C18H13Cl2F3N2O3/c1-7-3-9(18(21,22)23)4-10-8(2)6-25(14(7)10)16(26)12-13(19)11(17(27)28)5-24-15(12)20/h3-6,16,26H,1-2H3,(H,27,28) |
| InChIKey | OQHGXRPDCIDRSF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|