About (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid
(2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid (PubChem CID 163846929) has the molecular formula C14H24F2N2O3
and a molecular weight of 306.35 g/mol. Its IUPAC name is (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid.
Molecular Properties
| Compound Name | (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid |
| PubChem CID | 163846929 |
| Molecular Formula | C14H24F2N2O3 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CCCC1(CCNC(=O)N[C@@H](CC(C)(F)F)C(=O)O)CC1 |
| InChI | InChI=1S/C14H24F2N2O3/c1-3-4-14(5-6-14)7-8-17-12(21)18-10(11(19)20)9-13(2,15)16/h10H,3-9H2,1-2H3,(H,19,20)(H2,17,18,21)/t10-/m0/s1 |
| InChIKey | OQZXGZPMODQAQW-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid?
The IUPAC name of (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid (CID 163846929) is (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid.
What is the SMILES notation for (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid?
The canonical SMILES for (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid is CCCC1(CCNC(=O)N[C@@H](CC(C)(F)F)C(=O)O)CC1.
What is the InChIKey of (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid?
The InChIKey is OQZXGZPMODQAQW-JTQLQIEISA-N. The full InChI is InChI=1S/C14H24F2N2O3/c1-3-4-14(5-6-14)7-8-17-12(21)18-10(11(19)20)9-13(2,15)16/h10H,3-9H2,1-2H3,(H,19,20)(H2,17,18,21)/t10-/m0/s1.
What are the key properties of (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid?
(2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid has a molecular weight of 306.35 g/mol, XLogP of 2.75, 9 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-difluoro-2-[2-(1-propylcyclopropyl)ethylcarbamoylamino]pentanoic acid is sourced from PubChem (CID 163846929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).