C17H23NO2 — CID 163846995
2,3,5-trimethyl-6-[(E)-3-pyrrolidin-3-ylbut-2-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 163846995) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[(E)-3-pyrrolidin-3-ylbut-2-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-[(E)-3-pyrrolidin-3-ylbut-2-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 163846995 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2,3,5-trimethyl-6-[(E)-3-pyrrolidin-3-ylbut-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C/C=C(\C)C2CCNC2)=C(C)C1=O |
| InChI | InChI=1S/C17H23NO2/c1-10(14-7-8-18-9-14)5-6-15-13(4)16(19)11(2)12(3)17(15)20/h5,14,18H,6-9H2,1-4H3/b10-5+ |
| InChIKey | ORBCKKUOIZULEP-BJMVGYQFSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|