C8H16N5O3PS — CID 163847492
6-(diethoxyphosphorylsulfanylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 163847492) has the molecular formula C8H16N5O3PS and a molecular weight of 293.29 g/mol. Its IUPAC name is 6-(diethoxyphosphorylsulfanylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(diethoxyphosphorylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 163847492 |
| Molecular Formula | C8H16N5O3PS |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 6-(diethoxyphosphorylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOP(=O)(OCC)SCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C8H16N5O3PS/c1-3-15-17(14,16-4-2)18-5-6-11-7(9)13-8(10)12-6/h3-5H2,1-2H3,(H4,9,10,11,12,13) |
| InChIKey | ORLAUUZWYITUIW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|