C16H30N2O3 — CID 163847950
tert-butyl N-[1-[(1-methylpiperidin-4-yl)methoxy]but-3-enyl]carbamate (PubChem CID 163847950) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(1-methylpiperidin-4-yl)methoxy]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[(1-methylpiperidin-4-yl)methoxy]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 163847950 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl N-[1-[(1-methylpiperidin-4-yl)methoxy]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)OCC1CCN(C)CC1 |
| InChI | InChI=1S/C16H30N2O3/c1-6-7-14(17-15(19)21-16(2,3)4)20-12-13-8-10-18(5)11-9-13/h6,13-14H,1,7-12H2,2-5H3,(H,17,19) |
| InChIKey | ORUWQXPZTLHAEG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|