C15H17NO4 — CID 163847962
(4E,5E)-2-tert-butyl-5-ethylidene-4-(2-hydroxyethylidene)-1,3-benzoxazole-6,7-dione (PubChem CID 163847962) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (4E,5E)-2-tert-butyl-5-ethylidene-4-(2-hydroxyethylidene)-1,3-benzoxazole-6,7-dione.
| Compound Name | (4E,5E)-2-tert-butyl-5-ethylidene-4-(2-hydroxyethylidene)-1,3-benzoxazole-6,7-dione |
|---|---|
| PubChem CID | 163847962 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (4E,5E)-2-tert-butyl-5-ethylidene-4-(2-hydroxyethylidene)-1,3-benzoxazole-6,7-dione |
| SMILES | C/C=C1/C(=O)C(=O)c2oc(C(C)(C)C)nc2/C1=C/CO |
| InChI | InChI=1S/C15H17NO4/c1-5-8-9(6-7-17)10-13(12(19)11(8)18)20-14(16-10)15(2,3)4/h5-6,17H,7H2,1-4H3/b8-5+,9-6+ |
| InChIKey | ORVHBHWYTJSVBG-XVYDYJIPSA-N |
| XLogP | 2.06 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|