About 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine
2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine (PubChem CID 163847997) has the molecular formula C7H10IN3
and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine.
Molecular Properties
| Compound Name | 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine |
| PubChem CID | 163847997 |
| Molecular Formula | C7H10IN3 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine |
| SMILES | NC(N)=NC1=C(I)C=CCC1 |
| InChI | InChI=1S/C7H10IN3/c8-5-3-1-2-4-6(5)11-7(9)10/h1,3H,2,4H2,(H4,9,10,11) |
| InChIKey | ORWCWFFCDSKTNX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine?
The IUPAC name of 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine (CID 163847997) is 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine.
What is the SMILES notation for 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine?
The canonical SMILES for 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine is NC(N)=NC1=C(I)C=CCC1.
What is the InChIKey of 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine?
The InChIKey is ORWCWFFCDSKTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10IN3/c8-5-3-1-2-4-6(5)11-7(9)10/h1,3H,2,4H2,(H4,9,10,11).
What are the key properties of 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine?
2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine has a molecular weight of 263.08 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodocyclohexa-1,3-dien-1-yl)guanidine is sourced from PubChem (CID 163847997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).